C26H36N4O4 — CID 22849410
(2S)-N-[2-[acetamido-[3-(2,6-dimethylphenyl)propanoyl]amino]ethyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide (PubChem CID 22849410) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is (2S)-N-[2-[acetamido-[3-(2,6-dimethylphenyl)propanoyl]amino]ethyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide.
| Compound Name | (2S)-N-[2-[acetamido-[3-(2,6-dimethylphenyl)propanoyl]amino]ethyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 22849410 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (2S)-N-[2-[acetamido-[3-(2,6-dimethylphenyl)propanoyl]amino]ethyl]-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanamide |
| SMILES | CC(=O)NN(CCNC(=O)[C@@H](N)Cc1c(C)cc(O)cc1C)C(=O)CCc1c(C)cccc1C |
| InChI | InChI=1S/C26H36N4O4/c1-16-7-6-8-17(2)22(16)9-10-25(33)30(29-20(5)31)12-11-28-26(34)24(27)15-23-18(3)13-21(32)14-19(23)4/h6-8,13-14,24,32H,9-12,15,27H2,1-5H3,(H,28,34)(H,29,31)/t24-/m0/s1 |
| InChIKey | XBEKHNKOUKDERH-DEOSSOPVSA-N |
| XLogP | 2.12 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|