C11H16ClNO2 — CID 154728811
(2R)-2-amino-3-(2,6-dimethylphenyl)propanoic acid;hydrochloride (PubChem CID 154728811) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is (2R)-2-amino-3-(2,6-dimethylphenyl)propanoic acid;hydrochloride.
| Compound Name | (2R)-2-amino-3-(2,6-dimethylphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 154728811 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (2R)-2-amino-3-(2,6-dimethylphenyl)propanoic acid;hydrochloride |
| SMILES | Cc1cccc(C)c1C[C@@H](N)C(=O)O.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-7-4-3-5-8(2)9(7)6-10(12)11(13)14;/h3-5,10H,6,12H2,1-2H3,(H,13,14);1H/t10-;/m1./s1 |
| InChIKey | YBRVUWWIKIHZNE-HNCPQSOCSA-N |
| XLogP | 1.68 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |