C11H18ClN — CID 175702028
(2R)-1-(2,6-dimethylphenyl)propan-2-amine;hydrochloride (PubChem CID 175702028) has the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. Its IUPAC name is (2R)-1-(2,6-dimethylphenyl)propan-2-amine;hydrochloride.
| Compound Name | (2R)-1-(2,6-dimethylphenyl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 175702028 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | (2R)-1-(2,6-dimethylphenyl)propan-2-amine;hydrochloride |
| SMILES | Cc1cccc(C)c1C[C@@H](C)N.Cl |
| InChI | InChI=1S/C11H17N.ClH/c1-8-5-4-6-9(2)11(8)7-10(3)12;/h4-6,10H,7,12H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | IDNKIXRPAYMILL-HNCPQSOCSA-N |
| XLogP | 2.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |