C16H23N — CID 142606189
(2S)-3-cyclobutyl-1-(2,6-dimethylphenyl)but-3-en-2-amine (PubChem CID 142606189) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (2S)-3-cyclobutyl-1-(2,6-dimethylphenyl)but-3-en-2-amine.
| Compound Name | (2S)-3-cyclobutyl-1-(2,6-dimethylphenyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 142606189 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (2S)-3-cyclobutyl-1-(2,6-dimethylphenyl)but-3-en-2-amine |
| SMILES | C=C(C1CCC1)[C@@H](N)Cc1c(C)cccc1C |
| InChI | InChI=1S/C16H23N/c1-11-6-4-7-12(2)15(11)10-16(17)13(3)14-8-5-9-14/h4,6-7,14,16H,3,5,8-10,17H2,1-2H3/t16-/m0/s1 |
| InChIKey | RCPVNDBQVGZKMM-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|