C13H16O — CID 24724132
cyclobutyl-(2,6-dimethylphenyl)methanone (PubChem CID 24724132) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is cyclobutyl-(2,6-dimethylphenyl)methanone.
| Compound Name | cyclobutyl-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 24724132 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | cyclobutyl-(2,6-dimethylphenyl)methanone |
| SMILES | Cc1cccc(C)c1C(=O)C1CCC1 |
| InChI | InChI=1S/C13H16O/c1-9-5-3-6-10(2)12(9)13(14)11-7-4-8-11/h3,5-6,11H,4,7-8H2,1-2H3 |
| InChIKey | MLPMVPJDPBTASK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |