C14H18O — CID 24724167
cyclopentyl-(2,6-dimethylphenyl)methanone (PubChem CID 24724167) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is cyclopentyl-(2,6-dimethylphenyl)methanone.
| Compound Name | cyclopentyl-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 24724167 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | cyclopentyl-(2,6-dimethylphenyl)methanone |
| SMILES | Cc1cccc(C)c1C(=O)C1CCCC1 |
| InChI | InChI=1S/C14H18O/c1-10-6-5-7-11(2)13(10)14(15)12-8-3-4-9-12/h5-7,12H,3-4,8-9H2,1-2H3 |
| InChIKey | UXXVCUNAMBGRMQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |