C20H28N2O2 — CID 175039329
cyclohexyl-[3,6-diamino-2-(cyclohexanecarbonyl)phenyl]methanone (PubChem CID 175039329) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is cyclohexyl-[3,6-diamino-2-(cyclohexanecarbonyl)phenyl]methanone.
| Compound Name | cyclohexyl-[3,6-diamino-2-(cyclohexanecarbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 175039329 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | cyclohexyl-[3,6-diamino-2-(cyclohexanecarbonyl)phenyl]methanone |
| SMILES | Nc1ccc(N)c(C(=O)C2CCCCC2)c1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H28N2O2/c21-15-11-12-16(22)18(20(24)14-9-5-2-6-10-14)17(15)19(23)13-7-3-1-4-8-13/h11-14H,1-10,21-22H2 |
| InChIKey | JSAPTMNVEHRONH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|