About cyclohexyl-(4,6-diaminotriazin-5-yl)methanone
cyclohexyl-(4,6-diaminotriazin-5-yl)methanone (PubChem CID 141052840) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is cyclohexyl-(4,6-diaminotriazin-5-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(4,6-diaminotriazin-5-yl)methanone |
| PubChem CID | 141052840 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | cyclohexyl-(4,6-diaminotriazin-5-yl)methanone |
| SMILES | Nc1nnnc(N)c1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H15N5O/c11-9-7(10(12)14-15-13-9)8(16)6-4-2-1-3-5-6/h6H,1-5H2,(H4,11,12,13,14) |
| InChIKey | LTBFQQHNUHQJTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexyl-(4,6-diaminotriazin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(4,6-diaminotriazin-5-yl)methanone?
The IUPAC name of cyclohexyl-(4,6-diaminotriazin-5-yl)methanone (CID 141052840) is cyclohexyl-(4,6-diaminotriazin-5-yl)methanone.
What is the SMILES notation for cyclohexyl-(4,6-diaminotriazin-5-yl)methanone?
The canonical SMILES for cyclohexyl-(4,6-diaminotriazin-5-yl)methanone is Nc1nnnc(N)c1C(=O)C1CCCCC1.
What is the InChIKey of cyclohexyl-(4,6-diaminotriazin-5-yl)methanone?
The InChIKey is LTBFQQHNUHQJTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c11-9-7(10(12)14-15-13-9)8(16)6-4-2-1-3-5-6/h6H,1-5H2,(H4,11,12,13,14).
What are the key properties of cyclohexyl-(4,6-diaminotriazin-5-yl)methanone?
cyclohexyl-(4,6-diaminotriazin-5-yl)methanone has a molecular weight of 221.26 g/mol, XLogP of 0.80, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(4,6-diaminotriazin-5-yl)methanone is sourced from PubChem (CID 141052840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).