C10H15N5O — CID 141052840
cyclohexyl-(4,6-diaminotriazin-5-yl)methanone (PubChem CID 141052840) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is cyclohexyl-(4,6-diaminotriazin-5-yl)methanone.
| Compound Name | cyclohexyl-(4,6-diaminotriazin-5-yl)methanone |
|---|---|
| PubChem CID | 141052840 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | cyclohexyl-(4,6-diaminotriazin-5-yl)methanone |
| SMILES | Nc1nnnc(N)c1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H15N5O/c11-9-7(10(12)14-15-13-9)8(16)6-4-2-1-3-5-6/h6H,1-5H2,(H4,11,12,13,14) |
| InChIKey | LTBFQQHNUHQJTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |