About (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone
(5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone (PubChem CID 176892157) has the molecular formula C8H11N3OS
and a molecular weight of 197.26 g/mol. Its IUPAC name is (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone.
Molecular Properties
| Compound Name | (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone |
| PubChem CID | 176892157 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone |
| SMILES | Nc1nnc(C(=O)C2CCCC2)s1 |
| InChI | InChI=1S/C8H11N3OS/c9-8-11-10-7(13-8)6(12)5-3-1-2-4-5/h5H,1-4H2,(H2,9,11) |
| InChIKey | GCUSXNDWQHTFKI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone?
The IUPAC name of (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone (CID 176892157) is (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone.
What is the SMILES notation for (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone?
The canonical SMILES for (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone is Nc1nnc(C(=O)C2CCCC2)s1.
What is the InChIKey of (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone?
The InChIKey is GCUSXNDWQHTFKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS/c9-8-11-10-7(13-8)6(12)5-3-1-2-4-5/h5H,1-4H2,(H2,9,11).
What are the key properties of (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone?
(5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone has a molecular weight of 197.26 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone is sourced from PubChem (CID 176892157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).