C8H11N3OS — CID 176892157
(5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone (PubChem CID 176892157) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone.
| Compound Name | (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone |
|---|---|
| PubChem CID | 176892157 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (5-amino-1,3,4-thiadiazol-2-yl)-cyclopentylmethanone |
| SMILES | Nc1nnc(C(=O)C2CCCC2)s1 |
| InChI | InChI=1S/C8H11N3OS/c9-8-11-10-7(13-8)6(12)5-3-1-2-4-5/h5H,1-4H2,(H2,9,11) |
| InChIKey | GCUSXNDWQHTFKI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |