C15H24N2 — CID 103170732
[1-cyclobutyl-3-(2,6-dimethylphenyl)propan-2-yl]hydrazine (PubChem CID 103170732) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is [1-cyclobutyl-3-(2,6-dimethylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-cyclobutyl-3-(2,6-dimethylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103170732 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | [1-cyclobutyl-3-(2,6-dimethylphenyl)propan-2-yl]hydrazine |
| SMILES | Cc1cccc(C)c1CC(CC1CCC1)NN |
| InChI | InChI=1S/C15H24N2/c1-11-5-3-6-12(2)15(11)10-14(17-16)9-13-7-4-8-13/h3,5-6,13-14,17H,4,7-10,16H2,1-2H3 |
| InChIKey | VXJPFIHRXZRJOM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|