C17H28N2S — CID 105292785
[1-(thian-4-yl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine (PubChem CID 105292785) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is [1-(thian-4-yl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(thian-4-yl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105292785 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [1-(thian-4-yl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine |
| SMILES | Cc1cc(C)c(CC(CC2CCSCC2)NN)c(C)c1 |
| InChI | InChI=1S/C17H28N2S/c1-12-8-13(2)17(14(3)9-12)11-16(19-18)10-15-4-6-20-7-5-15/h8-9,15-16,19H,4-7,10-11,18H2,1-3H3 |
| InChIKey | XFBFPFJEFCBZTI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|