C19H31N — CID 115829164
1-cycloheptyl-3-(2,4,6-trimethylphenyl)propan-2-amine (PubChem CID 115829164) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,4,6-trimethylphenyl)propan-2-amine.
| Compound Name | 1-cycloheptyl-3-(2,4,6-trimethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 115829164 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 1-cycloheptyl-3-(2,4,6-trimethylphenyl)propan-2-amine |
| SMILES | Cc1cc(C)c(CC(N)CC2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C19H31N/c1-14-10-15(2)19(16(3)11-14)13-18(20)12-17-8-6-4-5-7-9-17/h10-11,17-18H,4-9,12-13,20H2,1-3H3 |
| InChIKey | LZQFYADOVHJHFN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |