C17H26FN — CID 106883593
2-cycloheptyl-1-(2-fluoro-4,6-dimethylphenyl)ethanamine (PubChem CID 106883593) has the molecular formula C17H26FN and a molecular weight of 263.40 g/mol. Its IUPAC name is 2-cycloheptyl-1-(2-fluoro-4,6-dimethylphenyl)ethanamine.
| Compound Name | 2-cycloheptyl-1-(2-fluoro-4,6-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 106883593 |
| Molecular Formula | C17H26FN |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-cycloheptyl-1-(2-fluoro-4,6-dimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)CC2CCCCCC2)c(F)c1 |
| InChI | InChI=1S/C17H26FN/c1-12-9-13(2)17(15(18)10-12)16(19)11-14-7-5-3-4-6-8-14/h9-10,14,16H,3-8,11,19H2,1-2H3 |
| InChIKey | QVYSWDARIUZCIY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |