C20H33N — CID 114457480
2-cycloheptyl-1-(2,3,4,5,6-pentamethylphenyl)ethanamine (PubChem CID 114457480) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is 2-cycloheptyl-1-(2,3,4,5,6-pentamethylphenyl)ethanamine.
| Compound Name | 2-cycloheptyl-1-(2,3,4,5,6-pentamethylphenyl)ethanamine |
|---|---|
| PubChem CID | 114457480 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 2-cycloheptyl-1-(2,3,4,5,6-pentamethylphenyl)ethanamine |
| SMILES | Cc1c(C)c(C)c(C(N)CC2CCCCCC2)c(C)c1C |
| InChI | InChI=1S/C20H33N/c1-13-14(2)16(4)20(17(5)15(13)3)19(21)12-18-10-8-6-7-9-11-18/h18-19H,6-12,21H2,1-5H3 |
| InChIKey | BISGRZMUDHOWKX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |