C19H30N2 — CID 105292666
[1-(2-bicyclo[2.2.1]heptanyl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine (PubChem CID 105292666) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is [1-(2-bicyclo[2.2.1]heptanyl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine.
| Compound Name | [1-(2-bicyclo[2.2.1]heptanyl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105292666 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | [1-(2-bicyclo[2.2.1]heptanyl)-3-(2,4,6-trimethylphenyl)propan-2-yl]hydrazine |
| SMILES | Cc1cc(C)c(CC(CC2CC3CCC2C3)NN)c(C)c1 |
| InChI | InChI=1S/C19H30N2/c1-12-6-13(2)19(14(3)7-12)11-18(21-20)10-17-9-15-4-5-16(17)8-15/h6-7,15-18,21H,4-5,8-11,20H2,1-3H3 |
| InChIKey | VWZUPZVTTZDXOR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|