C15H23NS — CID 105096944
1-(3,5-dimethylphenyl)-2-(thian-4-yl)ethanamine (PubChem CID 105096944) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-(thian-4-yl)ethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-(thian-4-yl)ethanamine |
|---|---|
| PubChem CID | 105096944 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-(thian-4-yl)ethanamine |
| SMILES | Cc1cc(C)cc(C(N)CC2CCSCC2)c1 |
| InChI | InChI=1S/C15H23NS/c1-11-7-12(2)9-14(8-11)15(16)10-13-3-5-17-6-4-13/h7-9,13,15H,3-6,10,16H2,1-2H3 |
| InChIKey | VKLLRSBTOFFZIP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |