C26H35N3O5 — CID 14599671
ethyl 4-[3-[[(2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]propanoyl]amino]propyl]benzoate (PubChem CID 14599671) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is ethyl 4-[3-[[(2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]propanoyl]amino]propyl]benzoate.
| Compound Name | ethyl 4-[3-[[(2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]propanoyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 14599671 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | ethyl 4-[3-[[(2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]propanoyl]amino]propyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCCNC(=O)[C@@H](C)NC(=O)C(N)Cc2c(C)cc(O)cc2C)cc1 |
| InChI | InChI=1S/C26H35N3O5/c1-5-34-26(33)20-10-8-19(9-11-20)7-6-12-28-24(31)18(4)29-25(32)23(27)15-22-16(2)13-21(30)14-17(22)3/h8-11,13-14,18,23,30H,5-7,12,15,27H2,1-4H3,(H,28,31)(H,29,32)/t18-,23?/m1/s1 |
| InChIKey | AVAQVVNZTPNJRJ-FKSKYRLFSA-N |
| XLogP | 2.31 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|