C26H37N3O3S — CID 14208584
(2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-4-ethylsulfanyl-N-(3-phenylpropyl)butanamide (PubChem CID 14208584) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is (2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-4-ethylsulfanyl-N-(3-phenylpropyl)butanamide.
| Compound Name | (2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-4-ethylsulfanyl-N-(3-phenylpropyl)butanamide |
|---|---|
| PubChem CID | 14208584 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | (2R)-2-[[2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-4-ethylsulfanyl-N-(3-phenylpropyl)butanamide |
| SMILES | CCSCC[C@@H](NC(=O)C(N)Cc1c(C)cc(O)cc1C)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C26H37N3O3S/c1-4-33-14-12-24(26(32)28-13-8-11-20-9-6-5-7-10-20)29-25(31)23(27)17-22-18(2)15-21(30)16-19(22)3/h5-7,9-10,15-16,23-24,30H,4,8,11-14,17,27H2,1-3H3,(H,28,32)(H,29,31)/t23?,24-/m1/s1 |
| InChIKey | KDEVUDIFNBSTQT-XMMISQBUSA-N |
| XLogP | 3.26 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|