C26H37N3O4S — CID 70407406
(6R)-2,6-diamino-4-ethylsulfinyl-7-(4-hydroxy-2,6-dimethylphenyl)-5-oxo-N-(3-phenylpropyl)heptanamide (PubChem CID 70407406) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is (6R)-2,6-diamino-4-ethylsulfinyl-7-(4-hydroxy-2,6-dimethylphenyl)-5-oxo-N-(3-phenylpropyl)heptanamide.
| Compound Name | (6R)-2,6-diamino-4-ethylsulfinyl-7-(4-hydroxy-2,6-dimethylphenyl)-5-oxo-N-(3-phenylpropyl)heptanamide |
|---|---|
| PubChem CID | 70407406 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (6R)-2,6-diamino-4-ethylsulfinyl-7-(4-hydroxy-2,6-dimethylphenyl)-5-oxo-N-(3-phenylpropyl)heptanamide |
| SMILES | CCS(=O)C(CC(N)C(=O)NCCCc1ccccc1)C(=O)[C@H](N)Cc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C26H37N3O4S/c1-4-34(33)24(25(31)22(27)15-21-17(2)13-20(30)14-18(21)3)16-23(28)26(32)29-12-8-11-19-9-6-5-7-10-19/h5-7,9-10,13-14,22-24,30H,4,8,11-12,15-16,27-28H2,1-3H3,(H,29,32)/t22-,23?,24?,34?/m1/s1 |
| InChIKey | SDEXHJPVQRWBCK-FTSKFDDRSA-N |
| XLogP | 2.05 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|