C30H36N4O4 — CID 14373516
[4-[(2S)-2-amino-3-oxo-3-[[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]amino]propyl]-3,5-dimethylphenyl] N-phenylcarbamate (PubChem CID 14373516) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-[[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]amino]propyl]-3,5-dimethylphenyl] N-phenylcarbamate.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-[[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]amino]propyl]-3,5-dimethylphenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 14373516 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-[[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]amino]propyl]-3,5-dimethylphenyl] N-phenylcarbamate |
| SMILES | Cc1cc(OC(=O)Nc2ccccc2)cc(C)c1C[C@H](N)C(=O)N[C@H](C)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C30H36N4O4/c1-20-17-25(38-30(37)34-24-14-8-5-9-15-24)18-21(2)26(20)19-27(31)29(36)33-22(3)28(35)32-16-10-13-23-11-6-4-7-12-23/h4-9,11-12,14-15,17-18,22,27H,10,13,16,19,31H2,1-3H3,(H,32,35)(H,33,36)(H,34,37)/t22-,27+/m1/s1 |
| InChIKey | QJCGYMTYWNMPJX-AMGIVPHBSA-N |
| XLogP | 4.04 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|