C31H39N3O3 — CID 14209584
3-(2,6-dimethyl-4-phenylmethoxyphenyl)-2-(methylamino)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide (PubChem CID 14209584) has the molecular formula C31H39N3O3 and a molecular weight of 501.67 g/mol. Its IUPAC name is 3-(2,6-dimethyl-4-phenylmethoxyphenyl)-2-(methylamino)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide.
| Compound Name | 3-(2,6-dimethyl-4-phenylmethoxyphenyl)-2-(methylamino)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 14209584 |
| Molecular Formula | C31H39N3O3 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | 3-(2,6-dimethyl-4-phenylmethoxyphenyl)-2-(methylamino)-N-[(2R)-1-oxo-1-(3-phenylpropylamino)propan-2-yl]propanamide |
| SMILES | CNC(Cc1c(C)cc(OCc2ccccc2)cc1C)C(=O)N[C@H](C)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C31H39N3O3/c1-22-18-27(37-21-26-14-9-6-10-15-26)19-23(2)28(22)20-29(32-4)31(36)34-24(3)30(35)33-17-11-16-25-12-7-5-8-13-25/h5-10,12-15,18-19,24,29,32H,11,16-17,20-21H2,1-4H3,(H,33,35)(H,34,36)/t24-,29?/m1/s1 |
| InChIKey | OJUQZDCQNMKNFP-OEXUWWALSA-N |
| XLogP | 4.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|