C21H27N3O4 — CID 13419955
(2S)-2-amino-N-[(2R)-3-hydroxy-1-oxo-1-(3-phenylpropylamino)propan-2-yl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 13419955) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2R)-3-hydroxy-1-oxo-1-(3-phenylpropylamino)propan-2-yl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(2R)-3-hydroxy-1-oxo-1-(3-phenylpropylamino)propan-2-yl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 13419955 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2S)-2-amino-N-[(2R)-3-hydroxy-1-oxo-1-(3-phenylpropylamino)propan-2-yl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](CO)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H27N3O4/c22-18(13-16-8-10-17(26)11-9-16)20(27)24-19(14-25)21(28)23-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,18-19,25-26H,4,7,12-14,22H2,(H,23,28)(H,24,27)/t18-,19+/m0/s1 |
| InChIKey | WRHUPCJQRQOCCI-RBUKOAKNSA-N |
| XLogP | 0.49 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|