C23H34ClN3O4 — CID 70485528
(2S)-2-amino-3-(4-hydroxyphenyl)-N-[(2R)-1-oxo-1-(5-phenylpentylamino)propan-2-yl]propanamide;hydrate;hydrochloride (PubChem CID 70485528) has the molecular formula C23H34ClN3O4 and a molecular weight of 452.00 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-hydroxyphenyl)-N-[(2R)-1-oxo-1-(5-phenylpentylamino)propan-2-yl]propanamide;hydrate;hydrochloride.
| Compound Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-[(2R)-1-oxo-1-(5-phenylpentylamino)propan-2-yl]propanamide;hydrate;hydrochloride |
|---|---|
| PubChem CID | 70485528 |
| Molecular Formula | C23H34ClN3O4 |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-[(2R)-1-oxo-1-(5-phenylpentylamino)propan-2-yl]propanamide;hydrate;hydrochloride |
| SMILES | C[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)NCCCCCc1ccccc1.Cl.O |
| InChI | InChI=1S/C23H31N3O3.ClH.H2O/c1-17(26-23(29)21(24)16-19-11-13-20(27)14-12-19)22(28)25-15-7-3-6-10-18-8-4-2-5-9-18;;/h2,4-5,8-9,11-14,17,21,27H,3,6-7,10,15-16,24H2,1H3,(H,25,28)(H,26,29);1H;1H2/t17-,21+;;/m1../s1 |
| InChIKey | XNSXCNBZNJIDNK-RUOOHMQISA-N |
| XLogP | 1.89 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|