C17H27N5O4 — CID 129187865
(2R)-2-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 129187865) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 129187865 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-3-(4-hydroxy-2,6-dimethylphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | Cc1cc(O)cc(C)c1C[C@H](N)C(=O)N[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H27N5O4/c1-9-6-11(23)7-10(2)12(9)8-13(18)15(24)22-14(16(25)26)4-3-5-21-17(19)20/h6-7,13-14,23H,3-5,8,18H2,1-2H3,(H,22,24)(H,25,26)(H4,19,20,21)/t13-,14+/m0/s1 |
| InChIKey | GXKBIHXXZGLFRD-UONOGXRCSA-N |
| XLogP | -0.50 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|