C11H15NO3 — CID 15730454
methyl (2R)-2-amino-3-(4-hydroxy-2-methylphenyl)propanoate (PubChem CID 15730454) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(4-hydroxy-2-methylphenyl)propanoate.
| Compound Name | methyl (2R)-2-amino-3-(4-hydroxy-2-methylphenyl)propanoate |
|---|---|
| PubChem CID | 15730454 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl (2R)-2-amino-3-(4-hydroxy-2-methylphenyl)propanoate |
| SMILES | COC(=O)[C@H](N)Cc1ccc(O)cc1C |
| InChI | InChI=1S/C11H15NO3/c1-7-5-9(13)4-3-8(7)6-10(12)11(14)15-2/h3-5,10,13H,6,12H2,1-2H3/t10-/m1/s1 |
| InChIKey | CBYXMOVGBHFPRO-SNVBAGLBSA-N |
| XLogP | 0.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |