C10H14N2O2 — CID 55277902
methyl (2R)-2-amino-3-(3-methyl-4-pyridinyl)propanoate (PubChem CID 55277902) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-(3-methyl-4-pyridinyl)propanoate.
| Compound Name | methyl (2R)-2-amino-3-(3-methyl-4-pyridinyl)propanoate |
|---|---|
| PubChem CID | 55277902 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | methyl (2R)-2-amino-3-(3-methyl-4-pyridinyl)propanoate |
| SMILES | COC(=O)[C@H](N)Cc1ccncc1C |
| InChI | InChI=1S/C10H14N2O2/c1-7-6-12-4-3-8(7)5-9(11)10(13)14-2/h3-4,6,9H,5,11H2,1-2H3/t9-/m1/s1 |
| InChIKey | KMYSTQSMOFHEDT-SECBINFHSA-N |
| XLogP | 0.43 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |