C8H14ClN3O2 — CID 170884317
methyl 2-amino-3-(5-methyl-1H-pyrazol-4-yl)propanoate;hydrochloride (PubChem CID 170884317) has the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. Its IUPAC name is methyl 2-amino-3-(5-methyl-1H-pyrazol-4-yl)propanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-(5-methyl-1H-pyrazol-4-yl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 170884317 |
| Molecular Formula | C8H14ClN3O2 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | methyl 2-amino-3-(5-methyl-1H-pyrazol-4-yl)propanoate;hydrochloride |
| SMILES | COC(=O)C(N)Cc1cn[nH]c1C.Cl |
| InChI | InChI=1S/C8H13N3O2.ClH/c1-5-6(4-10-11-5)3-7(9)8(12)13-2;/h4,7H,3,9H2,1-2H3,(H,10,11);1H |
| InChIKey | YOFWTVMGNFRIGQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |