C13H17N3O2 — CID 58864508
methyl 2-amino-3-(7-ethyl-1H-indazol-5-yl)propanoate (PubChem CID 58864508) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is methyl 2-amino-3-(7-ethyl-1H-indazol-5-yl)propanoate.
| Compound Name | methyl 2-amino-3-(7-ethyl-1H-indazol-5-yl)propanoate |
|---|---|
| PubChem CID | 58864508 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | methyl 2-amino-3-(7-ethyl-1H-indazol-5-yl)propanoate |
| SMILES | CCc1cc(CC(N)C(=O)OC)cc2cn[nH]c12 |
| InChI | InChI=1S/C13H17N3O2/c1-3-9-4-8(6-11(14)13(17)18-2)5-10-7-15-16-12(9)10/h4-5,7,11H,3,6,14H2,1-2H3,(H,15,16) |
| InChIKey | XVBDOJTZMGJLDM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |