C11H12ClN3O2 — CID 58864314
methyl 2-amino-3-(7-chloro-1H-indazol-5-yl)propanoate (PubChem CID 58864314) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is methyl 2-amino-3-(7-chloro-1H-indazol-5-yl)propanoate.
| Compound Name | methyl 2-amino-3-(7-chloro-1H-indazol-5-yl)propanoate |
|---|---|
| PubChem CID | 58864314 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | methyl 2-amino-3-(7-chloro-1H-indazol-5-yl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(Cl)c2[nH]ncc2c1 |
| InChI | InChI=1S/C11H12ClN3O2/c1-17-11(16)9(13)4-6-2-7-5-14-15-10(7)8(12)3-6/h2-3,5,9H,4,13H2,1H3,(H,14,15) |
| InChIKey | BEUQXXJKIQGBQT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |