C7H13Cl2N3O2 — CID 70074311
methyl (2S)-2-amino-3-(1H-pyrazol-5-yl)propanoate;dihydrochloride (PubChem CID 70074311) has the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.11 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(1H-pyrazol-5-yl)propanoate;dihydrochloride.
| Compound Name | methyl (2S)-2-amino-3-(1H-pyrazol-5-yl)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 70074311 |
| Molecular Formula | C7H13Cl2N3O2 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | methyl (2S)-2-amino-3-(1H-pyrazol-5-yl)propanoate;dihydrochloride |
| SMILES | COC(=O)[C@@H](N)Cc1ccn[nH]1.Cl.Cl |
| InChI | InChI=1S/C7H11N3O2.2ClH/c1-12-7(11)6(8)4-5-2-3-9-10-5;;/h2-3,6H,4,8H2,1H3,(H,9,10);2*1H/t6-;;/m0../s1 |
| InChIKey | KAKGRLQEIDHJGB-ILKKLZGPSA-N |
| XLogP | 0.30 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |