C12H17NO2 — CID 91978759
methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate (PubChem CID 91978759) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 91978759 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | methyl (2S)-2-amino-3-(2,4-dimethylphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(C)cc1C |
| InChI | InChI=1S/C12H17NO2/c1-8-4-5-10(9(2)6-8)7-11(13)12(14)15-3/h4-6,11H,7,13H2,1-3H3/t11-/m0/s1 |
| InChIKey | KOTSKKYJFZLKQL-NSHDSACASA-N |
| XLogP | 1.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |