C12H18N2O — CID 168863362
(3R)-3-amino-4-(2,4-dimethylphenyl)butanamide (PubChem CID 168863362) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,4-dimethylphenyl)butanamide.
| Compound Name | (3R)-3-amino-4-(2,4-dimethylphenyl)butanamide |
|---|---|
| PubChem CID | 168863362 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (3R)-3-amino-4-(2,4-dimethylphenyl)butanamide |
| SMILES | Cc1ccc(C[C@@H](N)CC(N)=O)c(C)c1 |
| InChI | InChI=1S/C12H18N2O/c1-8-3-4-10(9(2)5-8)6-11(13)7-12(14)15/h3-5,11H,6-7,13H2,1-2H3,(H2,14,15)/t11-/m1/s1 |
| InChIKey | YHENJIWIQDTUSR-LLVKDONJSA-N |
| XLogP | 1.05 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |