C12H20N2 — CID 162376806
(3S)-4-(2,4-dimethylphenyl)butane-1,3-diamine (PubChem CID 162376806) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (3S)-4-(2,4-dimethylphenyl)butane-1,3-diamine.
| Compound Name | (3S)-4-(2,4-dimethylphenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 162376806 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (3S)-4-(2,4-dimethylphenyl)butane-1,3-diamine |
| SMILES | Cc1ccc(C[C@H](N)CCN)c(C)c1 |
| InChI | InChI=1S/C12H20N2/c1-9-3-4-11(10(2)7-9)8-12(14)5-6-13/h3-4,7,12H,5-6,8,13-14H2,1-2H3/t12-/m1/s1 |
| InChIKey | QDXUBABJPILNQU-GFCCVEGCSA-N |
| XLogP | 1.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |