C12H19N — CID 95375920
(2R)-4-(2,4-dimethylphenyl)butan-2-amine (PubChem CID 95375920) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2R)-4-(2,4-dimethylphenyl)butan-2-amine.
| Compound Name | (2R)-4-(2,4-dimethylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 95375920 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2R)-4-(2,4-dimethylphenyl)butan-2-amine |
| SMILES | Cc1ccc(CC[C@@H](C)N)c(C)c1 |
| InChI | InChI=1S/C12H19N/c1-9-4-6-12(10(2)8-9)7-5-11(3)13/h4,6,8,11H,5,7,13H2,1-3H3/t11-/m1/s1 |
| InChIKey | PYYJTOJNWFMTBY-LLVKDONJSA-N |
| XLogP | 2.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |