C13H21N — CID 62550210
4-(2,4,6-trimethylphenyl)butan-2-amine (PubChem CID 62550210) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)butan-2-amine.
| Compound Name | 4-(2,4,6-trimethylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 62550210 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)butan-2-amine |
| SMILES | Cc1cc(C)c(CCC(C)N)c(C)c1 |
| InChI | InChI=1S/C13H21N/c1-9-7-10(2)13(11(3)8-9)6-5-12(4)14/h7-8,12H,5-6,14H2,1-4H3 |
| InChIKey | LMBMXUKPWSJKPG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |