About (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride
(2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride (PubChem CID 119288877) has the molecular formula C14H23ClN2O
and a molecular weight of 270.80 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride |
| PubChem CID | 119288877 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride |
| SMILES | Cc1cc(C)c(CCNC(=O)[C@@H](C)N)c(C)c1.Cl |
| InChI | InChI=1S/C14H22N2O.ClH/c1-9-7-10(2)13(11(3)8-9)5-6-16-14(17)12(4)15;/h7-8,12H,5-6,15H2,1-4H3,(H,16,17);1H/t12-;/m1./s1 |
| InChIKey | KEMQTDTWPVOTCG-UTONKHPSSA-N |
| XLogP | 2.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride?
The IUPAC name of (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride (CID 119288877) is (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride.
What is the SMILES notation for (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride?
The canonical SMILES for (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride is Cc1cc(C)c(CCNC(=O)[C@@H](C)N)c(C)c1.Cl.
What is the InChIKey of (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride?
The InChIKey is KEMQTDTWPVOTCG-UTONKHPSSA-N. The full InChI is InChI=1S/C14H22N2O.ClH/c1-9-7-10(2)13(11(3)8-9)5-6-16-14(17)12(4)15;/h7-8,12H,5-6,15H2,1-4H3,(H,16,17);1H/t12-;/m1./s1.
What are the key properties of (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride?
(2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride has a molecular weight of 270.80 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide;hydrochloride is sourced from PubChem (CID 119288877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).