C14H21NO2 — CID 115140912
2-hydroxy-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide (PubChem CID 115140912) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide.
| Compound Name | 2-hydroxy-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 115140912 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-hydroxy-N-[2-(2,4,6-trimethylphenyl)ethyl]propanamide |
| SMILES | Cc1cc(C)c(CCNC(=O)C(C)O)c(C)c1 |
| InChI | InChI=1S/C14H21NO2/c1-9-7-10(2)13(11(3)8-9)5-6-15-14(17)12(4)16/h7-8,12,16H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | HOCUGYNOIOPMCU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |