C14H21Cl — CID 64509110
1-(3-chloro-4-methylpentyl)-2,4-dimethylbenzene (PubChem CID 64509110) has the molecular formula C14H21Cl and a molecular weight of 224.78 g/mol. Its IUPAC name is 1-(3-chloro-4-methylpentyl)-2,4-dimethylbenzene.
| Compound Name | 1-(3-chloro-4-methylpentyl)-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 64509110 |
| Molecular Formula | C14H21Cl |
| Molecular Weight | 224.78 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(3-chloro-4-methylpentyl)-2,4-dimethylbenzene |
| SMILES | Cc1ccc(CCC(Cl)C(C)C)c(C)c1 |
| InChI | InChI=1S/C14H21Cl/c1-10(2)14(15)8-7-13-6-5-11(3)9-12(13)4/h5-6,9-10,14H,7-8H2,1-4H3 |
| InChIKey | JNNCXUQFTNXKPG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|