C14H24N2 — CID 154389351
7-(2-methylphenyl)heptane-1,6-diamine (PubChem CID 154389351) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 7-(2-methylphenyl)heptane-1,6-diamine.
| Compound Name | 7-(2-methylphenyl)heptane-1,6-diamine |
|---|---|
| PubChem CID | 154389351 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 7-(2-methylphenyl)heptane-1,6-diamine |
| SMILES | Cc1ccccc1CC(N)CCCCCN |
| InChI | InChI=1S/C14H24N2/c1-12-7-4-5-8-13(12)11-14(16)9-3-2-6-10-15/h4-5,7-8,14H,2-3,6,9-11,15-16H2,1H3 |
| InChIKey | WIJFYSYMOBHEQH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|