C17H19NO3 — CID 57157888
methyl (2S)-2-amino-3-(2-benzyl-4-hydroxyphenyl)propanoate (PubChem CID 57157888) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(2-benzyl-4-hydroxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(2-benzyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 57157888 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | methyl (2S)-2-amino-3-(2-benzyl-4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(O)cc1Cc1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-21-17(20)16(18)11-13-7-8-15(19)10-14(13)9-12-5-3-2-4-6-12/h2-8,10,16,19H,9,11,18H2,1H3/t16-/m0/s1 |
| InChIKey | AEFOIWPDOUOKNG-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |