C12H14N2O3 — CID 14288547
methyl 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoate (PubChem CID 14288547) has the molecular formula C12H14N2O3 and a molecular weight of 234.26 g/mol. Its IUPAC name is methyl 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 14288547 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | methyl 2-amino-3-(5-hydroxy-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(N)Cc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C12H14N2O3/c1-17-12(16)10(13)4-7-6-14-11-3-2-8(15)5-9(7)11/h2-3,5-6,10,14-15H,4,13H2,1H3 |
| InChIKey | QOBUNYVBTXFCEZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |