C13H17ClN2O3 — CID 69317062
methyl 3-(5-hydroxy-1H-indol-3-yl)-2-(methylamino)propanoate;hydrochloride (PubChem CID 69317062) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl 3-(5-hydroxy-1H-indol-3-yl)-2-(methylamino)propanoate;hydrochloride.
| Compound Name | methyl 3-(5-hydroxy-1H-indol-3-yl)-2-(methylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 69317062 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl 3-(5-hydroxy-1H-indol-3-yl)-2-(methylamino)propanoate;hydrochloride |
| SMILES | CNC(Cc1c[nH]c2ccc(O)cc12)C(=O)OC.Cl |
| InChI | InChI=1S/C13H16N2O3.ClH/c1-14-12(13(17)18-2)5-8-7-15-11-4-3-9(16)6-10(8)11;/h3-4,6-7,12,14-16H,5H2,1-2H3;1H |
| InChIKey | ZMJSZISEANFHIN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |