C15H22N2O2 — CID 145087532
ethane;4-(5-hydroxy-1H-indol-3-yl)-3-(methylamino)butan-2-one (PubChem CID 145087532) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethane;4-(5-hydroxy-1H-indol-3-yl)-3-(methylamino)butan-2-one.
| Compound Name | ethane;4-(5-hydroxy-1H-indol-3-yl)-3-(methylamino)butan-2-one |
|---|---|
| PubChem CID | 145087532 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethane;4-(5-hydroxy-1H-indol-3-yl)-3-(methylamino)butan-2-one |
| SMILES | CC.CNC(Cc1c[nH]c2ccc(O)cc12)C(C)=O |
| InChI | InChI=1S/C13H16N2O2.C2H6/c1-8(16)13(14-2)5-9-7-15-12-4-3-10(17)6-11(9)12;1-2/h3-4,6-7,13-15,17H,5H2,1-2H3;1-2H3 |
| InChIKey | VLYOZVFSJJUWRK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |