methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate

C12H12F2N2O2 — CID 166609513

IUPACmethyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate
SMILESCOC(=O)C(N)Cc1c[nH]c2cc(F)c(F)cc12
InChIInChI=1S/C12H12F2N2O2/c1-18-12(17)10(15)2-6-5-16-11-4-9(14)8(13)3-7(6)11/h3-5,10,16H,2,15H2,1H3
InChIKeyPMEWOTIPJSMTLA-UHFFFAOYSA-N
MW254.24 g/mol
LogP1.49
Rot. Bonds3

About methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate

methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate (PubChem CID 166609513) has the molecular formula C12H12F2N2O2 and a molecular weight of 254.24 g/mol. Its IUPAC name is methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate
PubChem CID166609513
Molecular FormulaC12H12F2N2O2
Molecular Weight254.24 g/mol
Exact Mass254.09
IUPAC Namemethyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate
SMILESCOC(=O)C(N)Cc1c[nH]c2cc(F)c(F)cc12
InChIInChI=1S/C12H12F2N2O2/c1-18-12(17)10(15)2-6-5-16-11-4-9(14)8(13)3-7(6)11/h3-5,10,16H,2,15H2,1H3
InChIKeyPMEWOTIPJSMTLA-UHFFFAOYSA-N
XLogP1.49
TPSA68.11 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.24
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate?
The IUPAC name of methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate (CID 166609513) is methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate?
The canonical SMILES for methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate is COC(=O)C(N)Cc1c[nH]c2cc(F)c(F)cc12.
What is the InChIKey of methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate?
The InChIKey is PMEWOTIPJSMTLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2O2/c1-18-12(17)10(15)2-6-5-16-11-4-9(14)8(13)3-7(6)11/h3-5,10,16H,2,15H2,1H3.
What are the key properties of methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate?
methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate has a molecular weight of 254.24 g/mol, XLogP of 1.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(5,6-difluoro-1H-indol-3-yl)propanoate is sourced from PubChem (CID 166609513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).