C19H20N2O3 — CID 94003873
methyl (2S)-2-amino-3-(6-phenylmethoxy-1H-indol-3-yl)propanoate (PubChem CID 94003873) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(6-phenylmethoxy-1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(6-phenylmethoxy-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 94003873 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl (2S)-2-amino-3-(6-phenylmethoxy-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1c[nH]c2cc(OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C19H20N2O3/c1-23-19(22)17(20)9-14-11-21-18-10-15(7-8-16(14)18)24-12-13-5-3-2-4-6-13/h2-8,10-11,17,21H,9,12,20H2,1H3/t17-/m0/s1 |
| InChIKey | PFVFGQWQOSCQCX-KRWDZBQOSA-N |
| XLogP | 2.79 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |