C24H30N2O5Si — CID 175217287
3-(6-phenylmethoxy-1H-indol-3-yl)-2-(2-trimethylsilylethoxycarbonylamino)propanoic acid (PubChem CID 175217287) has the molecular formula C24H30N2O5Si and a molecular weight of 454.60 g/mol. Its IUPAC name is 3-(6-phenylmethoxy-1H-indol-3-yl)-2-(2-trimethylsilylethoxycarbonylamino)propanoic acid.
| Compound Name | 3-(6-phenylmethoxy-1H-indol-3-yl)-2-(2-trimethylsilylethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 175217287 |
| Molecular Formula | C24H30N2O5Si |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-(6-phenylmethoxy-1H-indol-3-yl)-2-(2-trimethylsilylethoxycarbonylamino)propanoic acid |
| SMILES | C[Si](C)(C)CCOC(=O)NC(Cc1c[nH]c2cc(OCc3ccccc3)ccc12)C(=O)O |
| InChI | InChI=1S/C24H30N2O5Si/c1-32(2,3)12-11-30-24(29)26-22(23(27)28)13-18-15-25-21-14-19(9-10-20(18)21)31-16-17-7-5-4-6-8-17/h4-10,14-15,22,25H,11-13,16H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | XXKXQYDMKMIOAR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|