C8H9Cl2NO2S — CID 68973813
methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate (PubChem CID 68973813) has the molecular formula C8H9Cl2NO2S and a molecular weight of 254.14 g/mol. Its IUPAC name is methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate.
| Compound Name | methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate |
|---|---|
| PubChem CID | 68973813 |
| Molecular Formula | C8H9Cl2NO2S |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | methyl 2-amino-3-(2,5-dichlorothiophen-3-yl)propanoate |
| SMILES | COC(=O)C(N)Cc1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H9Cl2NO2S/c1-13-8(12)5(11)2-4-3-6(9)14-7(4)10/h3,5H,2,11H2,1H3 |
| InChIKey | YQICUKFRYZLYQE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |