C11H15ClN2O2 — CID 171238553
methyl (2S)-2-amino-3-(4-amino-2-chloro-5-methylphenyl)propanoate (PubChem CID 171238553) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(4-amino-2-chloro-5-methylphenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(4-amino-2-chloro-5-methylphenyl)propanoate |
|---|---|
| PubChem CID | 171238553 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl (2S)-2-amino-3-(4-amino-2-chloro-5-methylphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1cc(C)c(N)cc1Cl |
| InChI | InChI=1S/C11H15ClN2O2/c1-6-3-7(8(12)5-9(6)13)4-10(14)11(15)16-2/h3,5,10H,4,13-14H2,1-2H3/t10-/m0/s1 |
| InChIKey | UGJYFZOYTIGALJ-JTQLQIEISA-N |
| XLogP | 1.27 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|