C13H16ClNO3 — CID 171746443
methyl (2S)-2-amino-3-(5-chloro-2-cyclopropyloxyphenyl)propanoate (PubChem CID 171746443) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(5-chloro-2-cyclopropyloxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-amino-3-(5-chloro-2-cyclopropyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 171746443 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | methyl (2S)-2-amino-3-(5-chloro-2-cyclopropyloxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1cc(Cl)ccc1OC1CC1 |
| InChI | InChI=1S/C13H16ClNO3/c1-17-13(16)11(15)7-8-6-9(14)2-5-12(8)18-10-3-4-10/h2,5-6,10-11H,3-4,7,15H2,1H3/t11-/m0/s1 |
| InChIKey | IQVFURSSJHSGHW-NSHDSACASA-N |
| XLogP | 1.92 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |