methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate

C11H13F2NO3 — CID 171238466

IUPACmethyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate
SMILESCOC(=O)[C@@H](N)Cc1ccc(OC)c(F)c1F
InChIInChI=1S/C11H13F2NO3/c1-16-8-4-3-6(9(12)10(8)13)5-7(14)11(15)17-2/h3-4,7H,5,14H2,1-2H3/t7-/m0/s1
InChIKeyVTJAUBZLMDQGTJ-ZETCQYMHSA-N
MW245.22 g/mol
LogP1.02
Rot. Bonds4

About methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate

methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate (PubChem CID 171238466) has the molecular formula C11H13F2NO3 and a molecular weight of 245.22 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate.

Molecular Properties

Compound Namemethyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate
PubChem CID171238466
Molecular FormulaC11H13F2NO3
Molecular Weight245.22 g/mol
Exact Mass245.09
IUPAC Namemethyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate
SMILESCOC(=O)[C@@H](N)Cc1ccc(OC)c(F)c1F
InChIInChI=1S/C11H13F2NO3/c1-16-8-4-3-6(9(12)10(8)13)5-7(14)11(15)17-2/h3-4,7H,5,14H2,1-2H3/t7-/m0/s1
InChIKeyVTJAUBZLMDQGTJ-ZETCQYMHSA-N
XLogP1.02
TPSA61.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.22
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate?
The IUPAC name of methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate (CID 171238466) is methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate.
What is the SMILES notation for methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate?
The canonical SMILES for methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate is COC(=O)[C@@H](N)Cc1ccc(OC)c(F)c1F.
What is the InChIKey of methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate?
The InChIKey is VTJAUBZLMDQGTJ-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H13F2NO3/c1-16-8-4-3-6(9(12)10(8)13)5-7(14)11(15)17-2/h3-4,7H,5,14H2,1-2H3/t7-/m0/s1.
What are the key properties of methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate?
methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate has a molecular weight of 245.22 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-3-(2,3-difluoro-4-methoxyphenyl)propanoate is sourced from PubChem (CID 171238466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).